C9H9ClO3S — CID 130948581
3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinyl chloride (PubChem CID 130948581) has the molecular formula C9H9ClO3S and a molecular weight of 232.69 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinyl chloride.
| Compound Name | 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinyl chloride |
|---|---|
| PubChem CID | 130948581 |
| Molecular Formula | C9H9ClO3S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzodioxepine-7-sulfinyl chloride |
| SMILES | O=S(Cl)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C9H9ClO3S/c10-14(11)7-2-3-8-9(6-7)13-5-1-4-12-8/h2-3,6H,1,4-5H2 |
| InChIKey | JOEMMMHALIHUJW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |