C13H14O5S — CID 106436113
methyl (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)prop-2-enoate (PubChem CID 106436113) has the molecular formula C13H14O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)prop-2-enoate |
|---|---|
| PubChem CID | 106436113 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | methyl (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/S(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H14O5S/c1-16-13(14)5-8-19(15)10-3-4-11-12(9-10)18-7-2-6-17-11/h3-5,8-9H,2,6-7H2,1H3/b8-5+ |
| InChIKey | ZHSFCZAYEYEGRL-VMPITWQZSA-N |
| XLogP | 1.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|