C15H20O5S — CID 115479990
butyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)acetate (PubChem CID 115479990) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is butyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)acetate.
| Compound Name | butyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)acetate |
|---|---|
| PubChem CID | 115479990 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | butyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfinyl)acetate |
| SMILES | CCCCOC(=O)CS(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H20O5S/c1-2-3-7-20-15(16)11-21(17)12-5-6-13-14(10-12)19-9-4-8-18-13/h5-6,10H,2-4,7-9,11H2,1H3 |
| InChIKey | VTLUVFIHCKPKQT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|