C13H16O5 — CID 54941607
butyl 2-(1,3-benzodioxol-5-yloxy)acetate (PubChem CID 54941607) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is butyl 2-(1,3-benzodioxol-5-yloxy)acetate.
| Compound Name | butyl 2-(1,3-benzodioxol-5-yloxy)acetate |
|---|---|
| PubChem CID | 54941607 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | butyl 2-(1,3-benzodioxol-5-yloxy)acetate |
| SMILES | CCCCOC(=O)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16O5/c1-2-3-6-15-13(14)8-16-10-4-5-11-12(7-10)18-9-17-11/h4-5,7H,2-3,6,8-9H2,1H3 |
| InChIKey | FSQNQCITHPVKDN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|