C20H20O7 — CID 167442601
5-(1,3-benzodioxol-5-yloxy)pentyl 1,3-benzodioxole-5-carboxylate (PubChem CID 167442601) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxy)pentyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | 5-(1,3-benzodioxol-5-yloxy)pentyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 167442601 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yloxy)pentyl 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(OCCCCCOc1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20O7/c21-20(14-4-6-16-18(10-14)26-12-24-16)23-9-3-1-2-8-22-15-5-7-17-19(11-15)27-13-25-17/h4-7,10-11H,1-3,8-9,12-13H2 |
| InChIKey | MEYRZHPTXVAGJK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|