C15H11ClO4 — CID 2556848
(4-chlorophenyl)methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 2556848) has the molecular formula C15H11ClO4 and a molecular weight of 290.70 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2556848 |
| Molecular Formula | C15H11ClO4 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (4-chlorophenyl)methyl 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11ClO4/c16-12-4-1-10(2-5-12)8-18-15(17)11-3-6-13-14(7-11)20-9-19-13/h1-7H,8-9H2 |
| InChIKey | FIJQUDCFCRLTED-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |