C14H9Cl2NO4 — CID 56528427
(3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 56528427) has the molecular formula C14H9Cl2NO4 and a molecular weight of 326.14 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 56528427 |
| Molecular Formula | C14H9Cl2NO4 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(OCc1nc(Cl)ccc1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H9Cl2NO4/c15-9-2-4-13(16)17-10(9)6-19-14(18)8-1-3-11-12(5-8)21-7-20-11/h1-5H,6-7H2 |
| InChIKey | TWCYJPYJNVEPIS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|