(3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate

C14H9Cl2NO4 — CID 56528427

IUPAC(3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate
SMILESO=C(OCc1nc(Cl)ccc1Cl)c1ccc2c(c1)OCO2
InChIInChI=1S/C14H9Cl2NO4/c15-9-2-4-13(16)17-10(9)6-19-14(18)8-1-3-11-12(5-8)21-7-20-11/h1-5H,6-7H2
InChIKeyTWCYJPYJNVEPIS-UHFFFAOYSA-N
MW326.14 g/mol
LogP3.47
Rot. Bonds3

About (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate

(3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate (PubChem CID 56528427) has the molecular formula C14H9Cl2NO4 and a molecular weight of 326.14 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name(3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate
PubChem CID56528427
Molecular FormulaC14H9Cl2NO4
Molecular Weight326.14 g/mol
Exact Mass324.99
IUPAC Name(3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate
SMILESO=C(OCc1nc(Cl)ccc1Cl)c1ccc2c(c1)OCO2
InChIInChI=1S/C14H9Cl2NO4/c15-9-2-4-13(16)17-10(9)6-19-14(18)8-1-3-11-12(5-8)21-7-20-11/h1-5H,6-7H2
InChIKeyTWCYJPYJNVEPIS-UHFFFAOYSA-N
XLogP3.47
TPSA57.65 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.14
LogP ≤ 53.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate?
The IUPAC name of (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate (CID 56528427) is (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate is O=C(OCc1nc(Cl)ccc1Cl)c1ccc2c(c1)OCO2.
What is the InChIKey of (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate?
The InChIKey is TWCYJPYJNVEPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2NO4/c15-9-2-4-13(16)17-10(9)6-19-14(18)8-1-3-11-12(5-8)21-7-20-11/h1-5H,6-7H2.
What are the key properties of (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate?
(3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate has a molecular weight of 326.14 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,6-dichloro-2-pyridinyl)methyl 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 56528427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).