C23H17NO8 — CID 69355185
bis(1,3-benzodioxol-5-ylmethyl) pyridine-3,5-dicarboxylate (PubChem CID 69355185) has the molecular formula C23H17NO8 and a molecular weight of 435.39 g/mol. Its IUPAC name is bis(1,3-benzodioxol-5-ylmethyl) pyridine-3,5-dicarboxylate.
| Compound Name | bis(1,3-benzodioxol-5-ylmethyl) pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 69355185 |
| Molecular Formula | C23H17NO8 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | bis(1,3-benzodioxol-5-ylmethyl) pyridine-3,5-dicarboxylate |
| SMILES | O=C(OCc1ccc2c(c1)OCO2)c1cncc(C(=O)OCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C23H17NO8/c25-22(27-10-14-1-3-18-20(5-14)31-12-29-18)16-7-17(9-24-8-16)23(26)28-11-15-2-4-19-21(6-15)32-13-30-19/h1-9H,10-13H2 |
| InChIKey | ZHWHRNLGRUMHPN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |