C21H23NO6S — CID 7377152
1,3-benzodioxol-5-ylmethyl 4-(azepan-1-ylsulfonyl)benzoate (PubChem CID 7377152) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 4-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 4-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 7377152 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 4-(azepan-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1ccc2c(c1)OCO2)c1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H23NO6S/c23-21(26-14-16-5-10-19-20(13-16)28-15-27-19)17-6-8-18(9-7-17)29(24,25)22-11-3-1-2-4-12-22/h5-10,13H,1-4,11-12,14-15H2 |
| InChIKey | CZFIFMXZSYNPMW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |