(2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate

C19H21NO4S — CID 7767619

IUPAC(2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate
SMILESCc1ccccc1COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1
InChIInChI=1S/C19H21NO4S/c1-15-6-2-3-7-17(15)14-24-19(21)16-8-10-18(11-9-16)25(22,23)20-12-4-5-13-20/h2-3,6-11H,4-5,12-14H2,1H3
InChIKeyOODLYYKYKWAAPC-UHFFFAOYSA-N
MW359.45 g/mol
LogP3.14
Rot. Bonds5

About (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate

(2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 7767619) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate.

Molecular Properties

Compound Name(2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate
PubChem CID7767619
Molecular FormulaC19H21NO4S
Molecular Weight359.45 g/mol
Exact Mass359.12
IUPAC Name(2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate
SMILESCc1ccccc1COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1
InChIInChI=1S/C19H21NO4S/c1-15-6-2-3-7-17(15)14-24-19(21)16-8-10-18(11-9-16)25(22,23)20-12-4-5-13-20/h2-3,6-11H,4-5,12-14H2,1H3
InChIKeyOODLYYKYKWAAPC-UHFFFAOYSA-N
XLogP3.14
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500359.45
LogP ≤ 53.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate?
The IUPAC name of (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate (CID 7767619) is (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate.
What is the SMILES notation for (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate?
The canonical SMILES for (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate is Cc1ccccc1COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1.
What is the InChIKey of (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate?
The InChIKey is OODLYYKYKWAAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4S/c1-15-6-2-3-7-17(15)14-24-19(21)16-8-10-18(11-9-16)25(22,23)20-12-4-5-13-20/h2-3,6-11H,4-5,12-14H2,1H3.
What are the key properties of (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate?
(2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate has a molecular weight of 359.45 g/mol, XLogP of 3.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate is sourced from PubChem (CID 7767619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).