C17H20N2O5S — CID 8937003
(5-methyl-1,2-oxazol-3-yl)methyl 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 8937003) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 4-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl 4-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 8937003 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1cc(COC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)no1 |
| InChI | InChI=1S/C17H20N2O5S/c1-13-11-15(18-24-13)12-23-17(20)14-5-7-16(8-6-14)25(21,22)19-9-3-2-4-10-19/h5-8,11H,2-4,9-10,12H2,1H3 |
| InChIKey | XCPWAZAEDXOZTB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |