C19H18N2O5S2 — CID 16870213
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 16870213) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16870213 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cc(-c2cccs2)on1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H18N2O5S2/c22-19(25-13-15-12-17(26-20-15)18-4-3-11-27-18)14-5-7-16(8-6-14)28(23,24)21-9-1-2-10-21/h3-8,11-12H,1-2,9-10,13H2 |
| InChIKey | LNIMPYZOBUUNHL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |