C15H10FNO3S — CID 16870177
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-fluorobenzoate (PubChem CID 16870177) has the molecular formula C15H10FNO3S and a molecular weight of 303.31 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-fluorobenzoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-fluorobenzoate |
|---|---|
| PubChem CID | 16870177 |
| Molecular Formula | C15H10FNO3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-fluorobenzoate |
| SMILES | O=C(OCc1cc(-c2cccs2)on1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H10FNO3S/c16-11-4-1-3-10(7-11)15(18)19-9-12-8-13(20-17-12)14-5-2-6-21-14/h1-8H,9H2 |
| InChIKey | YPLAEEVIVVQHPH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |