C17H14N2O4S — CID 8741850
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-acetamidobenzoate (PubChem CID 8741850) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-acetamidobenzoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-acetamidobenzoate |
|---|---|
| PubChem CID | 8741850 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCc2cc(-c3cccs3)on2)c1 |
| InChI | InChI=1S/C17H14N2O4S/c1-11(20)18-13-5-2-4-12(8-13)17(21)22-10-14-9-15(23-19-14)16-6-3-7-24-16/h2-9H,10H2,1H3,(H,18,20) |
| InChIKey | RCMIUQJPUJYOPF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |