C17H16N2O5S2 — CID 30767092
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-(ethylsulfamoyl)benzoate (PubChem CID 30767092) has the molecular formula C17H16N2O5S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-(ethylsulfamoyl)benzoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30767092 |
| Molecular Formula | C17H16N2O5S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCc2cc(-c3cccs3)on2)c1 |
| InChI | InChI=1S/C17H16N2O5S2/c1-2-18-26(21,22)14-6-3-5-12(9-14)17(20)23-11-13-10-15(24-19-13)16-7-4-8-25-16/h3-10,18H,2,11H2,1H3 |
| InChIKey | NILSOWSXICHLHH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |