C15H11NO3S — CID 8648321
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl benzoate (PubChem CID 8648321) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl benzoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl benzoate |
|---|---|
| PubChem CID | 8648321 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl benzoate |
| SMILES | O=C(OCc1cc(-c2cccs2)on1)c1ccccc1 |
| InChI | InChI=1S/C15H11NO3S/c17-15(11-5-2-1-3-6-11)18-10-12-9-13(19-16-12)14-7-4-8-20-14/h1-9H,10H2 |
| InChIKey | GNZFOXMIBDWQBB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |