C24H20N2O4S — CID 55404439
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-benzamido-3-phenylpropanoate (PubChem CID 55404439) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-benzamido-3-phenylpropanoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 55404439 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 3-benzamido-3-phenylpropanoate |
| SMILES | O=C(CC(NC(=O)c1ccccc1)c1ccccc1)OCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C24H20N2O4S/c27-23(29-16-19-14-21(30-26-19)22-12-7-13-31-22)15-20(17-8-3-1-4-9-17)25-24(28)18-10-5-2-6-11-18/h1-14,20H,15-16H2,(H,25,28) |
| InChIKey | OFVNJIABORQNNN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |