C18H15NO4S — CID 26530325
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-oxo-4-phenylbutanoate (PubChem CID 26530325) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-oxo-4-phenylbutanoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 26530325 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-oxo-4-phenylbutanoate |
| SMILES | O=C(CCC(=O)c1ccccc1)OCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C18H15NO4S/c20-15(13-5-2-1-3-6-13)8-9-18(21)22-12-14-11-16(23-19-14)17-7-4-10-24-17/h1-7,10-11H,8-9,12H2 |
| InChIKey | KPNXQHYWICXIHE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |