C15H19N3O4S — CID 8973434
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 6-(carbamoylamino)hexanoate (PubChem CID 8973434) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 6-(carbamoylamino)hexanoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8973434 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 6-(carbamoylamino)hexanoate |
| SMILES | NC(=O)NCCCCCC(=O)OCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C15H19N3O4S/c16-15(20)17-7-3-1-2-6-14(19)21-10-11-9-12(22-18-11)13-5-4-8-23-13/h4-5,8-9H,1-3,6-7,10H2,(H3,16,17,20) |
| InChIKey | ZYEDOSIDJMIPPV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|