C12H19N3O4 — CID 40721472
(3-methyl-1,2-oxazol-5-yl)methyl 6-(carbamoylamino)hexanoate (PubChem CID 40721472) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 6-(carbamoylamino)hexanoate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 40721472 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 6-(carbamoylamino)hexanoate |
| SMILES | Cc1cc(COC(=O)CCCCCNC(N)=O)on1 |
| InChI | InChI=1S/C12H19N3O4/c1-9-7-10(19-15-9)8-18-11(16)5-3-2-4-6-14-12(13)17/h7H,2-6,8H2,1H3,(H3,13,14,17) |
| InChIKey | WJDCIVJGOCVLJC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|