About (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate
(3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate (PubChem CID 18123565) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate.
Analyze (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate?
The IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate (CID 18123565) is (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate.
What is the SMILES notation for (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate?
The canonical SMILES for (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate is Cc1cc(COC(=O)c2ccc(C)c(O)c2)on1.
What is the InChIKey of (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate?
The InChIKey is JGRKTWMSMCXWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c1-8-3-4-10(6-12(8)15)13(16)17-7-11-5-9(2)14-18-11/h3-6,15H,7H2,1-2H3.
What are the key properties of (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate?
(3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate has a molecular weight of 247.25 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-oxazol-5-yl)methyl 3-hydroxy-4-methylbenzoate is sourced from PubChem (CID 18123565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).