C12H11ClN2O5S — CID 32709670
(3-methyl-1,2-oxazol-5-yl)methyl 4-chloro-3-sulfamoylbenzoate (PubChem CID 32709670) has the molecular formula C12H11ClN2O5S and a molecular weight of 330.75 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 4-chloro-3-sulfamoylbenzoate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 32709670 |
| Molecular Formula | C12H11ClN2O5S |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 4-chloro-3-sulfamoylbenzoate |
| SMILES | Cc1cc(COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)on1 |
| InChI | InChI=1S/C12H11ClN2O5S/c1-7-4-9(20-15-7)6-19-12(16)8-2-3-10(13)11(5-8)21(14,17)18/h2-5H,6H2,1H3,(H2,14,17,18) |
| InChIKey | BZWUNIKLEDDFGM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |