C15H14ClNO4S2 — CID 2682456
(4-methylsulfanylphenyl)methyl 4-chloro-3-sulfamoylbenzoate (PubChem CID 2682456) has the molecular formula C15H14ClNO4S2 and a molecular weight of 371.87 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl 4-chloro-3-sulfamoylbenzoate.
| Compound Name | (4-methylsulfanylphenyl)methyl 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 2682456 |
| Molecular Formula | C15H14ClNO4S2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl 4-chloro-3-sulfamoylbenzoate |
| SMILES | CSc1ccc(COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C15H14ClNO4S2/c1-22-12-5-2-10(3-6-12)9-21-15(18)11-4-7-13(16)14(8-11)23(17,19)20/h2-8H,9H2,1H3,(H2,17,19,20) |
| InChIKey | QYAASEOOOVTGSJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |