C12H14ClNO5S — CID 39902965
[(2S)-oxolan-2-yl]methyl 4-chloro-3-sulfamoylbenzoate (PubChem CID 39902965) has the molecular formula C12H14ClNO5S and a molecular weight of 319.77 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [(2S)-oxolan-2-yl]methyl 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 39902965 |
| Molecular Formula | C12H14ClNO5S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 4-chloro-3-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OC[C@@H]2CCCO2)ccc1Cl |
| InChI | InChI=1S/C12H14ClNO5S/c13-10-4-3-8(6-11(10)20(14,16)17)12(15)19-7-9-2-1-5-18-9/h3-4,6,9H,1-2,5,7H2,(H2,14,16,17)/t9-/m0/s1 |
| InChIKey | BOQSCKOXOULFMH-VIFPVBQESA-N |
| XLogP | 1.32 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |