C13H16ClNO5S — CID 42915424
oxolan-2-ylmethyl 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 42915424) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | oxolan-2-ylmethyl 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42915424 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | oxolan-2-ylmethyl 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC2CCCO2)ccc1Cl |
| InChI | InChI=1S/C13H16ClNO5S/c1-15-21(17,18)12-7-9(4-5-11(12)14)13(16)20-8-10-3-2-6-19-10/h4-5,7,10,15H,2-3,6,8H2,1H3 |
| InChIKey | WVAQNHBIVVHDQZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |