C15H19ClN2O6S — CID 42902278
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 42902278) has the molecular formula C15H19ClN2O6S and a molecular weight of 390.85 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42902278 |
| Molecular Formula | C15H19ClN2O6S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)OCC(=O)NCC2CCCO2)ccc1Cl |
| InChI | InChI=1S/C15H19ClN2O6S/c1-17-25(21,22)13-7-10(4-5-12(13)16)15(20)24-9-14(19)18-8-11-3-2-6-23-11/h4-5,7,11,17H,2-3,6,8-9H2,1H3,(H,18,19) |
| InChIKey | VJKMYHLMETUUAQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |