C22H25ClN2O6S — CID 42979910
[2-(4-ethylanilino)-2-oxoethyl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42979910) has the molecular formula C22H25ClN2O6S and a molecular weight of 480.97 g/mol. Its IUPAC name is [2-(4-ethylanilino)-2-oxoethyl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-(4-ethylanilino)-2-oxoethyl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42979910 |
| Molecular Formula | C22H25ClN2O6S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [2-(4-ethylanilino)-2-oxoethyl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CCc1ccc(NC(=O)COC(=O)c2ccc(Cl)c(S(=O)(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C22H25ClN2O6S/c1-2-15-5-8-17(9-6-15)25-21(26)14-31-22(27)16-7-10-19(23)20(12-16)32(28,29)24-13-18-4-3-11-30-18/h5-10,12,18,24H,2-4,11,13-14H2,1H3,(H,25,26) |
| InChIKey | XUQVBXNAKUXYSC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |