C21H23ClFNO6S — CID 43022228
3-(4-fluorophenoxy)propyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 43022228) has the molecular formula C21H23ClFNO6S and a molecular weight of 471.93 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | 3-(4-fluorophenoxy)propyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 43022228 |
| Molecular Formula | C21H23ClFNO6S |
| Molecular Weight | 471.93 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCCCOc1ccc(F)cc1)c1ccc(Cl)c(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C21H23ClFNO6S/c22-19-9-4-15(13-20(19)31(26,27)24-14-18-3-1-10-29-18)21(25)30-12-2-11-28-17-7-5-16(23)6-8-17/h4-9,13,18,24H,1-3,10-12,14H2 |
| InChIKey | HFFUKDOLHAYBJT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|