C22H21ClN2O7S — CID 42915582
2-(1,3-dioxoisoindol-2-yl)ethyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42915582) has the molecular formula C22H21ClN2O7S and a molecular weight of 492.94 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42915582 |
| Molecular Formula | C22H21ClN2O7S |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccc(Cl)c(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C22H21ClN2O7S/c23-18-8-7-14(12-19(18)33(29,30)24-13-15-4-3-10-31-15)22(28)32-11-9-25-20(26)16-5-1-2-6-17(16)21(25)27/h1-2,5-8,12,15,24H,3-4,9-11,13H2 |
| InChIKey | AVQPDDUDMJABSL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|