C21H29ClN2O6S — CID 55422049
[1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 55422049) has the molecular formula C21H29ClN2O6S and a molecular weight of 472.99 g/mol. Its IUPAC name is [1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55422049 |
| Molecular Formula | C21H29ClN2O6S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(S(=O)(=O)NCC2CCCO2)c1)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C21H29ClN2O6S/c1-15(20(25)24-10-4-2-3-5-11-24)30-21(26)16-8-9-18(22)19(13-16)31(27,28)23-14-17-7-6-12-29-17/h8-9,13,15,17,23H,2-7,10-12,14H2,1H3 |
| InChIKey | MMZLSVBCDFXOJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |