C17H23ClN2O5S — CID 8884869
[(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 8884869) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8884869 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)O[C@@H](C)C(=O)N2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C17H23ClN2O5S/c1-12(16(21)20-9-5-3-4-6-10-20)25-17(22)13-7-8-14(18)15(11-13)26(23,24)19-2/h7-8,11-12,19H,3-6,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | WEYJZOLCCBYRJS-LBPRGKRZSA-N |
| XLogP | 2.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |