C22H24ClNO5S — CID 2514105
[(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2514105) has the molecular formula C22H24ClNO5S and a molecular weight of 449.96 g/mol. Its IUPAC name is [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2514105 |
| Molecular Formula | C22H24ClNO5S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [(2R)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](C)OC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H24ClNO5S/c1-15-6-8-17(9-7-15)21(25)16(2)29-22(26)18-10-11-19(23)20(14-18)30(27,28)24-12-4-3-5-13-24/h6-11,14,16H,3-5,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | SNNVVSKUVSBAOV-MRXNPFEDSA-N |
| XLogP | 4.25 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |