C17H22ClNO4S — CID 8764324
cyclohexyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 8764324) has the molecular formula C17H22ClNO4S and a molecular weight of 371.89 g/mol. Its IUPAC name is cyclohexyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | cyclohexyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 8764324 |
| Molecular Formula | C17H22ClNO4S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | cyclohexyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OC1CCCCC1)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H22ClNO4S/c18-15-9-8-13(17(20)23-14-6-2-1-3-7-14)12-16(15)24(21,22)19-10-4-5-11-19/h8-9,12,14H,1-7,10-11H2 |
| InChIKey | NRHTWPOYJNDVOT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |