C17H20ClNO6S — CID 2120682
[(3S)-2-oxooxolan-3-yl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate (PubChem CID 2120682) has the molecular formula C17H20ClNO6S and a molecular weight of 401.87 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 2120682 |
| Molecular Formula | C17H20ClNO6S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
| SMILES | O=C(O[C@H]1CCOC1=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C17H20ClNO6S/c18-13-6-5-12(16(20)25-14-7-10-24-17(14)21)11-15(13)26(22,23)19-8-3-1-2-4-9-19/h5-6,11,14H,1-4,7-10H2/t14-/m0/s1 |
| InChIKey | HQESTJHDJOEQFV-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |