C22H21ClN2O6S — CID 3664282
(1,3-dioxoisoindol-2-yl)methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate (PubChem CID 3664282) has the molecular formula C22H21ClN2O6S and a molecular weight of 476.94 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 3664282 |
| Molecular Formula | C22H21ClN2O6S |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C22H21ClN2O6S/c23-18-10-9-15(13-19(18)32(29,30)24-11-5-1-2-6-12-24)22(28)31-14-25-20(26)16-7-3-4-8-17(16)21(25)27/h3-4,7-10,13H,1-2,5-6,11-12,14H2 |
| InChIKey | MOAYDZVWLRDPCB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|