C21H21ClF3NO4S — CID 2550567
[2-(trifluoromethyl)phenyl]methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate (PubChem CID 2550567) has the molecular formula C21H21ClF3NO4S and a molecular weight of 475.92 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate.
| Compound Name | [2-(trifluoromethyl)phenyl]methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 2550567 |
| Molecular Formula | C21H21ClF3NO4S |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methyl 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
| SMILES | O=C(OCc1ccccc1C(F)(F)F)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H21ClF3NO4S/c22-18-10-9-15(13-19(18)31(28,29)26-11-5-1-2-6-12-26)20(27)30-14-16-7-3-4-8-17(16)21(23,24)25/h3-4,7-10,13H,1-2,5-6,11-12,14H2 |
| InChIKey | ZEJXBVVFPUCDPX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |