C17H16Cl2N2O4S — CID 31047981
(6-chloro-3-pyridinyl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 31047981) has the molecular formula C17H16Cl2N2O4S and a molecular weight of 415.30 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 31047981 |
| Molecular Formula | C17H16Cl2N2O4S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccc(Cl)nc1)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H16Cl2N2O4S/c18-14-5-4-13(9-15(14)26(23,24)21-7-1-2-8-21)17(22)25-11-12-3-6-16(19)20-10-12/h3-6,9-10H,1-2,7-8,11H2 |
| InChIKey | GIZZEUYCXLYIJT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|