C18H17BrClNO5S — CID 2495549
(4-bromophenyl)methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2495549) has the molecular formula C18H17BrClNO5S and a molecular weight of 474.76 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (4-bromophenyl)methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2495549 |
| Molecular Formula | C18H17BrClNO5S |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 472.97 |
| IUPAC Name | (4-bromophenyl)methyl 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ccc(Br)cc1)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H17BrClNO5S/c19-15-4-1-13(2-5-15)12-26-18(22)14-3-6-16(20)17(11-14)27(23,24)21-7-9-25-10-8-21/h1-6,11H,7-10,12H2 |
| InChIKey | VRYGRFZRVMFJEV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |