(6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate

C12H7Cl3N2O2 — CID 11449945

IUPAC(6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate
SMILESO=C(OCc1ccc(Cl)nc1)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C12H7Cl3N2O2/c13-9-2-1-7(5-16-9)6-19-12(18)8-3-10(14)17-11(15)4-8/h1-5H,6H2
InChIKeyLGBQZSUFHZPHMQ-UHFFFAOYSA-N
MW317.56 g/mol
LogP3.79
Rot. Bonds3

About (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate

(6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate (PubChem CID 11449945) has the molecular formula C12H7Cl3N2O2 and a molecular weight of 317.56 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate.

Molecular Properties

Compound Name(6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate
PubChem CID11449945
Molecular FormulaC12H7Cl3N2O2
Molecular Weight317.56 g/mol
Exact Mass315.96
IUPAC Name(6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate
SMILESO=C(OCc1ccc(Cl)nc1)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C12H7Cl3N2O2/c13-9-2-1-7(5-16-9)6-19-12(18)8-3-10(14)17-11(15)4-8/h1-5H,6H2
InChIKeyLGBQZSUFHZPHMQ-UHFFFAOYSA-N
XLogP3.79
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.56
LogP ≤ 53.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate?
The IUPAC name of (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate (CID 11449945) is (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate.
What is the SMILES notation for (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate?
The canonical SMILES for (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate is O=C(OCc1ccc(Cl)nc1)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate?
The InChIKey is LGBQZSUFHZPHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl3N2O2/c13-9-2-1-7(5-16-9)6-19-12(18)8-3-10(14)17-11(15)4-8/h1-5H,6H2.
What are the key properties of (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate?
(6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate has a molecular weight of 317.56 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate is sourced from PubChem (CID 11449945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).