C12H7Cl3N2O2 — CID 11449945
(6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate (PubChem CID 11449945) has the molecular formula C12H7Cl3N2O2 and a molecular weight of 317.56 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 11449945 |
| Molecular Formula | C12H7Cl3N2O2 |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 2,6-dichloropyridine-4-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)nc1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H7Cl3N2O2/c13-9-2-1-7(5-16-9)6-19-12(18)8-3-10(14)17-11(15)4-8/h1-5H,6H2 |
| InChIKey | LGBQZSUFHZPHMQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|