C17H14ClN3O4 — CID 34133472
(6-chloro-3-pyridinyl)methyl 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate (PubChem CID 34133472) has the molecular formula C17H14ClN3O4 and a molecular weight of 359.77 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 34133472 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate |
| SMILES | Cc1nc(COc2ccc(C(=O)OCc3ccc(Cl)nc3)cc2)no1 |
| InChI | InChI=1S/C17H14ClN3O4/c1-11-20-16(21-25-11)10-23-14-5-3-13(4-6-14)17(22)24-9-12-2-7-15(18)19-8-12/h2-8H,9-10H2,1H3 |
| InChIKey | UGFMYSYEEZGOJA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|