C9H6Cl4N2O3 — CID 56976750
(6-chloro-3-pyridinyl)methyl N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 56976750) has the molecular formula C9H6Cl4N2O3 and a molecular weight of 331.97 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl N-(2,2,2-trichloroacetyl)carbamate.
| Compound Name | (6-chloro-3-pyridinyl)methyl N-(2,2,2-trichloroacetyl)carbamate |
|---|---|
| PubChem CID | 56976750 |
| Molecular Formula | C9H6Cl4N2O3 |
| Molecular Weight | 331.97 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | O=C(NC(=O)C(Cl)(Cl)Cl)OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H6Cl4N2O3/c10-6-2-1-5(3-14-6)4-18-8(17)15-7(16)9(11,12)13/h1-3H,4H2,(H,15,16,17) |
| InChIKey | IQZYIZQVUVKPCY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|