C9H9ClN4O2 — CID 146298754
2-[(6-chloro-3-pyridinyl)methoxyamino]-2-cyanoacetamide (PubChem CID 146298754) has the molecular formula C9H9ClN4O2 and a molecular weight of 240.65 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methoxyamino]-2-cyanoacetamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methoxyamino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 146298754 |
| Molecular Formula | C9H9ClN4O2 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methoxyamino]-2-cyanoacetamide |
| SMILES | N#CC(NOCc1ccc(Cl)nc1)C(N)=O |
| InChI | InChI=1S/C9H9ClN4O2/c10-8-2-1-6(4-13-8)5-16-14-7(3-11)9(12)15/h1-2,4,7,14H,5H2,(H2,12,15) |
| InChIKey | ARHFEZITMMCKRX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|