C25H19ClN2O3 — CID 18281089
(6-chloro-3-pyridinyl)methyl 2-[(2-naphthalen-1-ylacetyl)amino]benzoate (PubChem CID 18281089) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 2-[(2-naphthalen-1-ylacetyl)amino]benzoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 2-[(2-naphthalen-1-ylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 18281089 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 2-[(2-naphthalen-1-ylacetyl)amino]benzoate |
| SMILES | O=C(Cc1cccc2ccccc12)Nc1ccccc1C(=O)OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C25H19ClN2O3/c26-23-13-12-17(15-27-23)16-31-25(30)21-10-3-4-11-22(21)28-24(29)14-19-8-5-7-18-6-1-2-9-20(18)19/h1-13,15H,14,16H2,(H,28,29) |
| InChIKey | LBHXNKKVFCVZND-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|