C10H7Cl3INO3 — CID 140781551
(4-iodophenyl)methyl N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 140781551) has the molecular formula C10H7Cl3INO3 and a molecular weight of 422.43 g/mol. Its IUPAC name is (4-iodophenyl)methyl N-(2,2,2-trichloroacetyl)carbamate.
| Compound Name | (4-iodophenyl)methyl N-(2,2,2-trichloroacetyl)carbamate |
|---|---|
| PubChem CID | 140781551 |
| Molecular Formula | C10H7Cl3INO3 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 420.85 |
| IUPAC Name | (4-iodophenyl)methyl N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | O=C(NC(=O)C(Cl)(Cl)Cl)OCc1ccc(I)cc1 |
| InChI | InChI=1S/C10H7Cl3INO3/c11-10(12,13)8(16)15-9(17)18-5-6-1-3-7(14)4-2-6/h1-4H,5H2,(H,15,16,17) |
| InChIKey | NSRSLYQSJMUEJW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|