About (4-methylphenyl)methyl N-aminocarbamate
(4-methylphenyl)methyl N-aminocarbamate (PubChem CID 13494891) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is (4-methylphenyl)methyl N-aminocarbamate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl N-aminocarbamate |
| PubChem CID | 13494891 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (4-methylphenyl)methyl N-aminocarbamate |
| SMILES | Cc1ccc(COC(=O)NN)cc1 |
| InChI | InChI=1S/C9H12N2O2/c1-7-2-4-8(5-3-7)6-13-9(12)11-10/h2-5H,6,10H2,1H3,(H,11,12) |
| InChIKey | IBERFVNCKLYYDX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)methyl N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl N-aminocarbamate?
The IUPAC name of (4-methylphenyl)methyl N-aminocarbamate (CID 13494891) is (4-methylphenyl)methyl N-aminocarbamate.
What is the SMILES notation for (4-methylphenyl)methyl N-aminocarbamate?
The canonical SMILES for (4-methylphenyl)methyl N-aminocarbamate is Cc1ccc(COC(=O)NN)cc1.
What is the InChIKey of (4-methylphenyl)methyl N-aminocarbamate?
The InChIKey is IBERFVNCKLYYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-7-2-4-8(5-3-7)6-13-9(12)11-10/h2-5H,6,10H2,1H3,(H,11,12).
What are the key properties of (4-methylphenyl)methyl N-aminocarbamate?
(4-methylphenyl)methyl N-aminocarbamate has a molecular weight of 180.21 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl N-aminocarbamate is sourced from PubChem (CID 13494891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).