About iodo (4-methylphenyl)methyl carbonate
iodo (4-methylphenyl)methyl carbonate (PubChem CID 170151158) has the molecular formula C9H9IO3
and a molecular weight of 292.07 g/mol. Its IUPAC name is iodo (4-methylphenyl)methyl carbonate.
Molecular Properties
| Compound Name | iodo (4-methylphenyl)methyl carbonate |
| PubChem CID | 170151158 |
| Molecular Formula | C9H9IO3 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | iodo (4-methylphenyl)methyl carbonate |
| SMILES | Cc1ccc(COC(=O)OI)cc1 |
| InChI | InChI=1S/C9H9IO3/c1-7-2-4-8(5-3-7)6-12-9(11)13-10/h2-5H,6H2,1H3 |
| InChIKey | RVUWOVCFVPQWRP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodo (4-methylphenyl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo (4-methylphenyl)methyl carbonate?
The IUPAC name of iodo (4-methylphenyl)methyl carbonate (CID 170151158) is iodo (4-methylphenyl)methyl carbonate.
What is the SMILES notation for iodo (4-methylphenyl)methyl carbonate?
The canonical SMILES for iodo (4-methylphenyl)methyl carbonate is Cc1ccc(COC(=O)OI)cc1.
What is the InChIKey of iodo (4-methylphenyl)methyl carbonate?
The InChIKey is RVUWOVCFVPQWRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IO3/c1-7-2-4-8(5-3-7)6-12-9(11)13-10/h2-5H,6H2,1H3.
What are the key properties of iodo (4-methylphenyl)methyl carbonate?
iodo (4-methylphenyl)methyl carbonate has a molecular weight of 292.07 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodo (4-methylphenyl)methyl carbonate is sourced from PubChem (CID 170151158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).