C22H21N3O12 — CID 162254315
bis(2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate (PubChem CID 162254315) has the molecular formula C22H21N3O12 and a molecular weight of 519.42 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate |
|---|---|
| PubChem CID | 162254315 |
| Molecular Formula | C22H21N3O12 |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) carbonate;(2,5-dioxopyrrolidin-1-yl) (4-methylphenyl)methyl carbonate |
| SMILES | Cc1ccc(COC(=O)ON2C(=O)CCC2=O)cc1.O=C(ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H13NO5.C9H8N2O7/c1-9-2-4-10(5-3-9)8-18-13(17)19-14-11(15)6-7-12(14)16;12-5-1-2-6(13)10(5)17-9(16)18-11-7(14)3-4-8(11)15/h2-5H,6-8H2,1H3;1-4H2 |
| InChIKey | ZYJYDACBFNRSQT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 183.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|