C20H25NO8 — CID 90124555
[4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-methyl-4-propoxybutanoate (PubChem CID 90124555) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is [4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-methyl-4-propoxybutanoate.
| Compound Name | [4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-methyl-4-propoxybutanoate |
|---|---|
| PubChem CID | 90124555 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl]phenyl] 2-methyl-4-propoxybutanoate |
| SMILES | CCCOCCC(C)C(=O)Oc1ccc(COC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C20H25NO8/c1-3-11-26-12-10-14(2)19(24)28-16-6-4-15(5-7-16)13-27-20(25)29-21-17(22)8-9-18(21)23/h4-7,14H,3,8-13H2,1-2H3 |
| InChIKey | UWZNJTHPGBWUFW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|