C29H46N4O13 — CID 165397687
(2,5-dioxopyrrolidin-1-yl) [4-[(2-formamidoacetyl)amino]phenyl]methyl carbonate;2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 165397687) has the molecular formula C29H46N4O13 and a molecular weight of 658.70 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [4-[(2-formamidoacetyl)amino]phenyl]methyl carbonate;2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [4-[(2-formamidoacetyl)amino]phenyl]methyl carbonate;2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 165397687 |
| Molecular Formula | C29H46N4O13 |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [4-[(2-formamidoacetyl)amino]phenyl]methyl carbonate;2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | CCOCCOCCOCCOCCOCCOCCN.O=CNCC(=O)Nc1ccc(COC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C15H15N3O7.C14H31NO6/c19-9-16-7-12(20)17-11-3-1-10(2-4-11)8-24-15(23)25-18-13(21)5-6-14(18)22;1-2-16-5-6-18-9-10-20-13-14-21-12-11-19-8-7-17-4-3-15/h1-4,9H,5-8H2,(H,16,19)(H,17,20);2-15H2,1H3 |
| InChIKey | QWYQBFNNLVUJQI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 212.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|