C7H8N2O5 — CID 59502327
(2,5-dioxopyrrolidin-1-yl) 2-formamidoacetate (PubChem CID 59502327) has the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-formamidoacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-formamidoacetate |
|---|---|
| PubChem CID | 59502327 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-formamidoacetate |
| SMILES | O=CNCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C7H8N2O5/c10-4-8-3-7(13)14-9-5(11)1-2-6(9)12/h4H,1-3H2,(H,8,10) |
| InChIKey | IRDDTBYIMIGMRR-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|